C15H24O3Si — CID 59977335
methyl 2-[(2Z,5Z)-9-trimethylsilylnona-2,5-dien-8-ynoxy]acetate (PubChem CID 59977335) has the molecular formula C15H24O3Si and a molecular weight of 280.44 g/mol. Its IUPAC name is methyl 2-[(2Z,5Z)-9-trimethylsilylnona-2,5-dien-8-ynoxy]acetate.
| Compound Name | methyl 2-[(2Z,5Z)-9-trimethylsilylnona-2,5-dien-8-ynoxy]acetate |
|---|---|
| PubChem CID | 59977335 |
| Molecular Formula | C15H24O3Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | methyl 2-[(2Z,5Z)-9-trimethylsilylnona-2,5-dien-8-ynoxy]acetate |
| SMILES | COC(=O)COC/C=C\C/C=C\CC#C[Si](C)(C)C |
| InChI | InChI=1S/C15H24O3Si/c1-17-15(16)14-18-12-10-8-6-5-7-9-11-13-19(2,3)4/h5,7-8,10H,6,9,12,14H2,1-4H3/b7-5-,10-8- |
| InChIKey | DGOLYZXGRYHVFY-RRMOSLQNSA-N |
| XLogP | 2.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|