C16H26O4 — CID 59977346
2-[(2Z,8Z,10E)-12-hydroxy-12-methyltrideca-2,8,10-trienoxy]acetic acid (PubChem CID 59977346) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-[(2Z,8Z,10E)-12-hydroxy-12-methyltrideca-2,8,10-trienoxy]acetic acid.
| Compound Name | 2-[(2Z,8Z,10E)-12-hydroxy-12-methyltrideca-2,8,10-trienoxy]acetic acid |
|---|---|
| PubChem CID | 59977346 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2-[(2Z,8Z,10E)-12-hydroxy-12-methyltrideca-2,8,10-trienoxy]acetic acid |
| SMILES | CC(C)(O)/C=C/C=C\CCCC/C=C\COCC(=O)O |
| InChI | InChI=1S/C16H26O4/c1-16(2,19)12-10-8-6-4-3-5-7-9-11-13-20-14-15(17)18/h6,8-12,19H,3-5,7,13-14H2,1-2H3,(H,17,18)/b8-6-,11-9-,12-10+ |
| InChIKey | WIKFCTQNNDYOJG-MJUGGFHOSA-N |
| XLogP | 3.09 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|