C44H72O2 — CID 59977353
(6E,10E,14E,16E,18E,22E,26E)-12,21-dimethoxy-2,6,8,10,14,19,23,25,27,31-decamethyldotriaconta-2,6,10,14,16,18,22,26,30-nonaene (PubChem CID 59977353) has the molecular formula C44H72O2 and a molecular weight of 633.06 g/mol. Its IUPAC name is (6E,10E,14E,16E,18E,22E,26E)-12,21-dimethoxy-2,6,8,10,14,19,23,25,27,31-decamethyldotriaconta-2,6,10,14,16,18,22,26,30-nonaene.
| Compound Name | (6E,10E,14E,16E,18E,22E,26E)-12,21-dimethoxy-2,6,8,10,14,19,23,25,27,31-decamethyldotriaconta-2,6,10,14,16,18,22,26,30-nonaene |
|---|---|
| PubChem CID | 59977353 |
| Molecular Formula | C44H72O2 |
| Molecular Weight | 633.06 g/mol |
| Exact Mass | 632.55 |
| IUPAC Name | (6E,10E,14E,16E,18E,22E,26E)-12,21-dimethoxy-2,6,8,10,14,19,23,25,27,31-decamethyldotriaconta-2,6,10,14,16,18,22,26,30-nonaene |
| SMILES | COC(/C=C(\C)CC(C)/C=C(\C)CCC=C(C)C)C/C(C)=C/C=C/C=C(\C)CC(/C=C(\C)CC(C)/C=C(\C)CCC=C(C)C)OC |
| InChI | InChI=1S/C44H72O2/c1-33(2)19-17-23-35(5)25-39(9)27-41(11)31-43(45-13)29-37(7)21-15-16-22-38(8)30-44(46-14)32-42(12)28-40(10)26-36(6)24-18-20-34(3)4/h15-16,19-22,25-26,31-32,39-40,43-44H,17-18,23-24,27-30H2,1-14H3/b16-15+,35-25+,36-26+,37-21+,38-22+,41-31+,42-32+ |
| InChIKey | QJRHYWRJKCZJOZ-WTHOYHNGSA-N |
| XLogP | 13.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.06 |
| LogP ≤ 5 | 13.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|