C16H18N6O4S2 — CID 59977713
(2R,5R)-2-(hydroxymethyl)-5-[6-[(pyridin-2-yldisulfanyl)methylamino]purin-9-yl]oxolane-3,4-diol (PubChem CID 59977713) has the molecular formula C16H18N6O4S2 and a molecular weight of 422.49 g/mol. Its IUPAC name is (2R,5R)-2-(hydroxymethyl)-5-[6-[(pyridin-2-yldisulfanyl)methylamino]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-(hydroxymethyl)-5-[6-[(pyridin-2-yldisulfanyl)methylamino]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 59977713 |
| Molecular Formula | C16H18N6O4S2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | (2R,5R)-2-(hydroxymethyl)-5-[6-[(pyridin-2-yldisulfanyl)methylamino]purin-9-yl]oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(NCSSc4ccccn4)ncnc32)C(O)C1O |
| InChI | InChI=1S/C16H18N6O4S2/c23-5-9-12(24)13(25)16(26-9)22-7-20-11-14(18-6-19-15(11)22)21-8-27-28-10-3-1-2-4-17-10/h1-4,6-7,9,12-13,16,23-25H,5,8H2,(H,18,19,21)/t9-,12?,13?,16-/m1/s1 |
| InChIKey | GCUOTILWRYNAMN-RCLQZVNMSA-N |
| XLogP | 0.64 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|