C11H19NO5 — CID 59977789
methyl (4R)-3-hydroxy-2-(1-hydroxy-2-methylpropyl)-4-methyl-5-oxopyrrolidine-2-carboxylate (PubChem CID 59977789) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is methyl (4R)-3-hydroxy-2-(1-hydroxy-2-methylpropyl)-4-methyl-5-oxopyrrolidine-2-carboxylate.
| Compound Name | methyl (4R)-3-hydroxy-2-(1-hydroxy-2-methylpropyl)-4-methyl-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 59977789 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | methyl (4R)-3-hydroxy-2-(1-hydroxy-2-methylpropyl)-4-methyl-5-oxopyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1(C(O)C(C)C)NC(=O)[C@H](C)C1O |
| InChI | InChI=1S/C11H19NO5/c1-5(2)7(13)11(10(16)17-4)8(14)6(3)9(15)12-11/h5-8,13-14H,1-4H3,(H,12,15)/t6-,7?,8?,11?/m1/s1 |
| InChIKey | ONXMGBPSJUZJNU-IVQBWCDJSA-N |
| XLogP | -0.96 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |