C22H36N2Si — CID 59978327
N-[dimethyl-(2-methyl-6,6a,7,8,9,10,10a,10b-octahydro-5aH-indeno[2,1-b]indol-5-yl)silyl]-2-methylpropan-2-amine (PubChem CID 59978327) has the molecular formula C22H36N2Si and a molecular weight of 356.63 g/mol. Its IUPAC name is N-[dimethyl-(2-methyl-6,6a,7,8,9,10,10a,10b-octahydro-5aH-indeno[2,1-b]indol-5-yl)silyl]-2-methylpropan-2-amine.
| Compound Name | N-[dimethyl-(2-methyl-6,6a,7,8,9,10,10a,10b-octahydro-5aH-indeno[2,1-b]indol-5-yl)silyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 59978327 |
| Molecular Formula | C22H36N2Si |
| Molecular Weight | 356.63 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | N-[dimethyl-(2-methyl-6,6a,7,8,9,10,10a,10b-octahydro-5aH-indeno[2,1-b]indol-5-yl)silyl]-2-methylpropan-2-amine |
| SMILES | Cc1ccc2c(c1)C1C3CCCCC3CC1N2[Si](C)(C)NC(C)(C)C |
| InChI | InChI=1S/C22H36N2Si/c1-15-11-12-19-18(13-15)21-17-10-8-7-9-16(17)14-20(21)24(19)25(5,6)23-22(2,3)4/h11-13,16-17,20-21,23H,7-10,14H2,1-6H3 |
| InChIKey | RBXKUQWEOPEMRM-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.63 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|