C24H16F3N3O4 — CID 59978347
(10R)-10-(1,3-benzodioxol-5-yl)-2-formyl-1-(trifluoromethyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide (PubChem CID 59978347) has the molecular formula C24H16F3N3O4 and a molecular weight of 467.40 g/mol. Its IUPAC name is (10R)-10-(1,3-benzodioxol-5-yl)-2-formyl-1-(trifluoromethyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide.
| Compound Name | (10R)-10-(1,3-benzodioxol-5-yl)-2-formyl-1-(trifluoromethyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 59978347 |
| Molecular Formula | C24H16F3N3O4 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | (10R)-10-(1,3-benzodioxol-5-yl)-2-formyl-1-(trifluoromethyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide |
| SMILES | NC(=O)c1c(C=O)c(C(F)(F)F)n2c1Cc1c([nH]c3ccccc13)[C@H]2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H16F3N3O4/c25-24(26,27)22-14(9-31)19(23(28)32)16-8-13-12-3-1-2-4-15(12)29-20(13)21(30(16)22)11-5-6-17-18(7-11)34-10-33-17/h1-7,9,21,29H,8,10H2,(H2,28,32)/t21-/m1/s1 |
| InChIKey | PHYRAVGOERSCQI-OAQYLSRUSA-N |
| XLogP | 4.17 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|