C19H23N3O5 — CID 59978551
cis-ethyl (1R,2S)-2-(hydroxycarbamoyl)-1-[[4-[(3-methylimidazol-4-yl)methoxy]phenyl]methyl]cyclopropane-1-carboxylate (PubChem CID 59978551) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is cis-ethyl (1R,2S)-2-(hydroxycarbamoyl)-1-[[4-[(3-methylimidazol-4-yl)methoxy]phenyl]methyl]cyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2S)-2-(hydroxycarbamoyl)-1-[[4-[(3-methylimidazol-4-yl)methoxy]phenyl]methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 59978551 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | cis-ethyl (1R,2S)-2-(hydroxycarbamoyl)-1-[[4-[(3-methylimidazol-4-yl)methoxy]phenyl]methyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Cc2ccc(OCc3cncn3C)cc2)C[C@@H]1C(=O)NO |
| InChI | InChI=1S/C19H23N3O5/c1-3-26-18(24)19(9-16(19)17(23)21-25)8-13-4-6-15(7-5-13)27-11-14-10-20-12-22(14)2/h4-7,10,12,16,25H,3,8-9,11H2,1-2H3,(H,21,23)/t16-,19+/m1/s1 |
| InChIKey | LLCYVUPBVIAHCR-APWZRJJASA-N |
| XLogP | 1.62 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|