C20H19Cl2NO5 — CID 59978678
cis-ethyl (1R,2S)-1-[[4-(3,5-dichlorophenoxy)phenyl]methyl]-2-(hydroxycarbamoyl)cyclopropane-1-carboxylate (PubChem CID 59978678) has the molecular formula C20H19Cl2NO5 and a molecular weight of 424.28 g/mol. Its IUPAC name is cis-ethyl (1R,2S)-1-[[4-(3,5-dichlorophenoxy)phenyl]methyl]-2-(hydroxycarbamoyl)cyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2S)-1-[[4-(3,5-dichlorophenoxy)phenyl]methyl]-2-(hydroxycarbamoyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 59978678 |
| Molecular Formula | C20H19Cl2NO5 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | cis-ethyl (1R,2S)-1-[[4-(3,5-dichlorophenoxy)phenyl]methyl]-2-(hydroxycarbamoyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Cc2ccc(Oc3cc(Cl)cc(Cl)c3)cc2)C[C@@H]1C(=O)NO |
| InChI | InChI=1S/C20H19Cl2NO5/c1-2-27-19(25)20(11-17(20)18(24)23-26)10-12-3-5-15(6-4-12)28-16-8-13(21)7-14(22)9-16/h3-9,17,26H,2,10-11H2,1H3,(H,23,24)/t17-,20+/m1/s1 |
| InChIKey | AZWZSYWRUGFPSV-XLIONFOSSA-N |
| XLogP | 4.40 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|