C13H21- — CID 59979364
2,3,3a,4,5,5a,6,7,8,9,9a,9b-dodecahydro-1H-cyclopenta[a]naphthalen-2-ide (PubChem CID 59979364) has the molecular formula C13H21- and a molecular weight of 177.31 g/mol. Its IUPAC name is 2,3,3a,4,5,5a,6,7,8,9,9a,9b-dodecahydro-1H-cyclopenta[a]naphthalen-2-ide.
| Compound Name | 2,3,3a,4,5,5a,6,7,8,9,9a,9b-dodecahydro-1H-cyclopenta[a]naphthalen-2-ide |
|---|---|
| PubChem CID | 59979364 |
| Molecular Formula | C13H21- |
| Molecular Weight | 177.31 g/mol |
| Exact Mass | 177.16 |
| IUPAC Name | 2,3,3a,4,5,5a,6,7,8,9,9a,9b-dodecahydro-1H-cyclopenta[a]naphthalen-2-ide |
| SMILES | [CH-]1CC2CCC3CCCCC3C2C1 |
| InChI | InChI=1S/C13H21/c1-2-6-12-10(4-1)8-9-11-5-3-7-13(11)12/h3,10-13H,1-2,4-9H2/q-1 |
| InChIKey | UUKVVPVJIPHRHC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|