C15H38O9Si5 — CID 59979369
2-[4-(1,5-dioxocan-3-yl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl-trimethoxysilane (PubChem CID 59979369) has the molecular formula C15H38O9Si5 and a molecular weight of 502.89 g/mol. Its IUPAC name is 2-[4-(1,5-dioxocan-3-yl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl-trimethoxysilane.
| Compound Name | 2-[4-(1,5-dioxocan-3-yl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl-trimethoxysilane |
|---|---|
| PubChem CID | 59979369 |
| Molecular Formula | C15H38O9Si5 |
| Molecular Weight | 502.89 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 2-[4-(1,5-dioxocan-3-yl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl-trimethoxysilane |
| SMILES | CO[Si](CC[Si]1(C)O[SiH](C)O[SiH](C)O[Si](C)(C2COCCCOC2)O1)(OC)OC |
| InChI | InChI=1S/C15H38O9Si5/c1-16-29(17-2,18-3)12-11-27(6)22-25(4)21-26(5)23-28(7,24-27)15-13-19-9-8-10-20-14-15/h15,25-26H,8-14H2,1-7H3 |
| InChIKey | JMJLJYBJXGRQSN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.89 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|