C34H44N2O5 — CID 59979664
(4S,4aR,5aS,12aR)-2-acetyl-4,7-bis(dimethylamino)-9-hex-1-ynyl-4a,5a-dihydroxy-3,10,12,12a-tetramethyl-5,6-dihydro-4H-tetracene-1,11-dione (PubChem CID 59979664) has the molecular formula C34H44N2O5 and a molecular weight of 560.74 g/mol. Its IUPAC name is (4S,4aR,5aS,12aR)-2-acetyl-4,7-bis(dimethylamino)-9-hex-1-ynyl-4a,5a-dihydroxy-3,10,12,12a-tetramethyl-5,6-dihydro-4H-tetracene-1,11-dione.
| Compound Name | (4S,4aR,5aS,12aR)-2-acetyl-4,7-bis(dimethylamino)-9-hex-1-ynyl-4a,5a-dihydroxy-3,10,12,12a-tetramethyl-5,6-dihydro-4H-tetracene-1,11-dione |
|---|---|
| PubChem CID | 59979664 |
| Molecular Formula | C34H44N2O5 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | (4S,4aR,5aS,12aR)-2-acetyl-4,7-bis(dimethylamino)-9-hex-1-ynyl-4a,5a-dihydroxy-3,10,12,12a-tetramethyl-5,6-dihydro-4H-tetracene-1,11-dione |
| SMILES | CCCCC#Cc1cc(N(C)C)c2c(c1C)C(=O)C1=C(C)[C@@]3(C)C(=O)C(C(C)=O)=C(C)[C@H](N(C)C)[C@@]3(O)C[C@@]1(O)C2 |
| InChI | InChI=1S/C34H44N2O5/c1-11-12-13-14-15-23-16-25(35(7)8)24-17-33(40)18-34(41)30(36(9)10)20(3)26(22(5)37)31(39)32(34,6)21(4)28(33)29(38)27(24)19(23)2/h16,30,40-41H,11-13,17-18H2,1-10H3/t30-,32-,33-,34-/m0/s1 |
| InChIKey | BTTBNXNAQXDBNB-DYTOPAQESA-N |
| XLogP | 3.95 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|