C25H31N2O2S2+ — CID 59979907
(2E)-6-ethoxy-2-[(E)-3-(6-ethoxy-3-ethyl-6,7-dihydro-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-ethyl-1,3-benzothiazole (PubChem CID 59979907) has the molecular formula C25H31N2O2S2+ and a molecular weight of 455.67 g/mol. Its IUPAC name is (2E)-6-ethoxy-2-[(E)-3-(6-ethoxy-3-ethyl-6,7-dihydro-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-ethyl-1,3-benzothiazole.
| Compound Name | (2E)-6-ethoxy-2-[(E)-3-(6-ethoxy-3-ethyl-6,7-dihydro-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-ethyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 59979907 |
| Molecular Formula | C25H31N2O2S2+ |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | (2E)-6-ethoxy-2-[(E)-3-(6-ethoxy-3-ethyl-6,7-dihydro-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-ethyl-1,3-benzothiazole |
| SMILES | CCOc1ccc2c(c1)S/C(=C/C=C/c1sc3c([n+]1CC)C=CC(OCC)C3)N2CC |
| InChI | InChI=1S/C25H31N2O2S2/c1-5-26-20-14-12-18(28-7-3)16-22(20)30-24(26)10-9-11-25-27(6-2)21-15-13-19(29-8-4)17-23(21)31-25/h9-16,19H,5-8,17H2,1-4H3/q+1 |
| InChIKey | HKYHQWFUYMYOQL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 25.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|