C18H12F3N3O — CID 59980991
6-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-ethynyl-2-fluorophenyl)-2,3-difluoroaniline (PubChem CID 59980991) has the molecular formula C18H12F3N3O and a molecular weight of 343.31 g/mol. Its IUPAC name is 6-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-ethynyl-2-fluorophenyl)-2,3-difluoroaniline.
| Compound Name | 6-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-ethynyl-2-fluorophenyl)-2,3-difluoroaniline |
|---|---|
| PubChem CID | 59980991 |
| Molecular Formula | C18H12F3N3O |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 6-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-ethynyl-2-fluorophenyl)-2,3-difluoroaniline |
| SMILES | C#Cc1ccc(Nc2c(-c3nnc(CC)o3)ccc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C18H12F3N3O/c1-3-10-5-8-14(13(20)9-10)22-17-11(6-7-12(19)16(17)21)18-24-23-15(4-2)25-18/h1,5-9,22H,4H2,2H3 |
| InChIKey | XEUUJACJCAIJNB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|