C26H38O2 — CID 59981133
ethyl (2E,4E)-5-[(1S,2R,3R)-2-[3,5-di(propan-2-yl)phenyl]-3-ethyl-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate (PubChem CID 59981133) has the molecular formula C26H38O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is ethyl (2E,4E)-5-[(1S,2R,3R)-2-[3,5-di(propan-2-yl)phenyl]-3-ethyl-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-[(1S,2R,3R)-2-[3,5-di(propan-2-yl)phenyl]-3-ethyl-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 59981133 |
| Molecular Formula | C26H38O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | ethyl (2E,4E)-5-[(1S,2R,3R)-2-[3,5-di(propan-2-yl)phenyl]-3-ethyl-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/[C@H]1[C@@H](CC)[C@@]1(C)c1cc(C(C)C)cc(C(C)C)c1 |
| InChI | InChI=1S/C26H38O2/c1-9-23-24(12-11-19(7)13-25(27)28-10-2)26(23,8)22-15-20(17(3)4)14-21(16-22)18(5)6/h11-18,23-24H,9-10H2,1-8H3/b12-11+,19-13+/t23-,24+,26-/m1/s1 |
| InChIKey | AGTGBNUCARALSB-XUANJZKSSA-N |
| XLogP | 6.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|