About 4-O-ethoxycarbonyl 1-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] butanedioate
4-O-ethoxycarbonyl 1-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] butanedioate (PubChem CID 59981143) has the molecular formula C17H28O6
and a molecular weight of 328.41 g/mol. Its IUPAC name is 4-O-ethoxycarbonyl 1-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] butanedioate.
Molecular Properties
| Compound Name | 4-O-ethoxycarbonyl 1-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] butanedioate |
| PubChem CID | 59981143 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 4-O-ethoxycarbonyl 1-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] butanedioate |
| SMILES | CCOC(=O)OC(=O)CCC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C17H28O6/c1-5-21-17(20)23-16(19)9-8-15(18)22-14-10-12(4)6-7-13(14)11(2)3/h11-14H,5-10H2,1-4H3/t12-,13+,14-/m1/s1 |
| InChIKey | ZJFARJYCTBYWAW-HZSPNIEDSA-N |
| XLogP | 3.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-O-ethoxycarbonyl 1-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-ethoxycarbonyl 1-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] butanedioate?
The IUPAC name of 4-O-ethoxycarbonyl 1-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] butanedioate (CID 59981143) is 4-O-ethoxycarbonyl 1-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] butanedioate.
What is the SMILES notation for 4-O-ethoxycarbonyl 1-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] butanedioate?
The canonical SMILES for 4-O-ethoxycarbonyl 1-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] butanedioate is CCOC(=O)OC(=O)CCC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C.
What is the InChIKey of 4-O-ethoxycarbonyl 1-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] butanedioate?
The InChIKey is ZJFARJYCTBYWAW-HZSPNIEDSA-N. The full InChI is InChI=1S/C17H28O6/c1-5-21-17(20)23-16(19)9-8-15(18)22-14-10-12(4)6-7-13(14)11(2)3/h11-14H,5-10H2,1-4H3/t12-,13+,14-/m1/s1.
What are the key properties of 4-O-ethoxycarbonyl 1-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] butanedioate?
4-O-ethoxycarbonyl 1-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] butanedioate has a molecular weight of 328.41 g/mol, XLogP of 3.47, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-ethoxycarbonyl 1-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] butanedioate is sourced from PubChem (CID 59981143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).