C23H22FN7O4S — CID 59981333
N-[4-(4-amino-1-cyclopentylpyrazolo[3,4-d]pyrimidin-3-yl)-2-fluorophenyl]-1-(2-nitrophenyl)methanesulfonamide (PubChem CID 59981333) has the molecular formula C23H22FN7O4S and a molecular weight of 511.54 g/mol. Its IUPAC name is N-[4-(4-amino-1-cyclopentylpyrazolo[3,4-d]pyrimidin-3-yl)-2-fluorophenyl]-1-(2-nitrophenyl)methanesulfonamide.
| Compound Name | N-[4-(4-amino-1-cyclopentylpyrazolo[3,4-d]pyrimidin-3-yl)-2-fluorophenyl]-1-(2-nitrophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 59981333 |
| Molecular Formula | C23H22FN7O4S |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | N-[4-(4-amino-1-cyclopentylpyrazolo[3,4-d]pyrimidin-3-yl)-2-fluorophenyl]-1-(2-nitrophenyl)methanesulfonamide |
| SMILES | Nc1ncnc2c1c(-c1ccc(NS(=O)(=O)Cc3ccccc3[N+](=O)[O-])c(F)c1)nn2C1CCCC1 |
| InChI | InChI=1S/C23H22FN7O4S/c24-17-11-14(21-20-22(25)26-13-27-23(20)30(28-21)16-6-2-3-7-16)9-10-18(17)29-36(34,35)12-15-5-1-4-8-19(15)31(32)33/h1,4-5,8-11,13,16,29H,2-3,6-7,12H2,(H2,25,26,27) |
| InChIKey | IYUYNINPECITSM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 158.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|