C21H39N3O7 — CID 59981539
2-[[5-[(butan-2-ylideneamino)peroxymethylamino]-1,3,3-trimethylcyclohexyl]methylcarbamoyloxymethyl]-3-hydroxy-2-methylpropanoic acid (PubChem CID 59981539) has the molecular formula C21H39N3O7 and a molecular weight of 445.56 g/mol. Its IUPAC name is 2-[[5-[(butan-2-ylideneamino)peroxymethylamino]-1,3,3-trimethylcyclohexyl]methylcarbamoyloxymethyl]-3-hydroxy-2-methylpropanoic acid.
| Compound Name | 2-[[5-[(butan-2-ylideneamino)peroxymethylamino]-1,3,3-trimethylcyclohexyl]methylcarbamoyloxymethyl]-3-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 59981539 |
| Molecular Formula | C21H39N3O7 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | 2-[[5-[(butan-2-ylideneamino)peroxymethylamino]-1,3,3-trimethylcyclohexyl]methylcarbamoyloxymethyl]-3-hydroxy-2-methylpropanoic acid |
| SMILES | CCC(C)=NOOCNC1CC(C)(C)CC(C)(CNC(=O)OCC(C)(CO)C(=O)O)C1 |
| InChI | InChI=1S/C21H39N3O7/c1-7-15(2)24-31-30-14-23-16-8-19(3,4)10-20(5,9-16)11-22-18(28)29-13-21(6,12-25)17(26)27/h16,23,25H,7-14H2,1-6H3,(H,22,28)(H,26,27) |
| InChIKey | GUSRSCUTKJLYHJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 138.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|