About N-(4-tert-butylcyclopenta-1,3-dien-1-yl)-2,2-dimethylpropanamide
N-(4-tert-butylcyclopenta-1,3-dien-1-yl)-2,2-dimethylpropanamide (PubChem CID 59981577) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is N-(4-tert-butylcyclopenta-1,3-dien-1-yl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(4-tert-butylcyclopenta-1,3-dien-1-yl)-2,2-dimethylpropanamide |
| PubChem CID | 59981577 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N-(4-tert-butylcyclopenta-1,3-dien-1-yl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC1=CC=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C14H23NO/c1-13(2,3)10-7-8-11(9-10)15-12(16)14(4,5)6/h7-8H,9H2,1-6H3,(H,15,16) |
| InChIKey | WMXCONOELNIWOF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(4-tert-butylcyclopenta-1,3-dien-1-yl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-tert-butylcyclopenta-1,3-dien-1-yl)-2,2-dimethylpropanamide?
The IUPAC name of N-(4-tert-butylcyclopenta-1,3-dien-1-yl)-2,2-dimethylpropanamide (CID 59981577) is N-(4-tert-butylcyclopenta-1,3-dien-1-yl)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(4-tert-butylcyclopenta-1,3-dien-1-yl)-2,2-dimethylpropanamide?
The canonical SMILES for N-(4-tert-butylcyclopenta-1,3-dien-1-yl)-2,2-dimethylpropanamide is CC(C)(C)C(=O)NC1=CC=C(C(C)(C)C)C1.
What is the InChIKey of N-(4-tert-butylcyclopenta-1,3-dien-1-yl)-2,2-dimethylpropanamide?
The InChIKey is WMXCONOELNIWOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO/c1-13(2,3)10-7-8-11(9-10)15-12(16)14(4,5)6/h7-8H,9H2,1-6H3,(H,15,16).
What are the key properties of N-(4-tert-butylcyclopenta-1,3-dien-1-yl)-2,2-dimethylpropanamide?
N-(4-tert-butylcyclopenta-1,3-dien-1-yl)-2,2-dimethylpropanamide has a molecular weight of 221.34 g/mol, XLogP of 3.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-tert-butylcyclopenta-1,3-dien-1-yl)-2,2-dimethylpropanamide is sourced from PubChem (CID 59981577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).