C17H19NO2S — CID 59981986
N-(6-ethyl-9-oxo-5,6,7,8-tetrahydrothioxanthen-3-yl)acetamide (PubChem CID 59981986) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is N-(6-ethyl-9-oxo-5,6,7,8-tetrahydrothioxanthen-3-yl)acetamide.
| Compound Name | N-(6-ethyl-9-oxo-5,6,7,8-tetrahydrothioxanthen-3-yl)acetamide |
|---|---|
| PubChem CID | 59981986 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-(6-ethyl-9-oxo-5,6,7,8-tetrahydrothioxanthen-3-yl)acetamide |
| SMILES | CCC1CCc2c(sc3cc(NC(C)=O)ccc3c2=O)C1 |
| InChI | InChI=1S/C17H19NO2S/c1-3-11-4-6-13-15(8-11)21-16-9-12(18-10(2)19)5-7-14(16)17(13)20/h5,7,9,11H,3-4,6,8H2,1-2H3,(H,18,19) |
| InChIKey | XGDMLPUINQYDGT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |