About 2-phenyl-N,N-bis(trimethylsilyl)ethanamine
2-phenyl-N,N-bis(trimethylsilyl)ethanamine (PubChem CID 599825) has the molecular formula C14H27NSi2
and a molecular weight of 265.55 g/mol. Its IUPAC name is 2-phenyl-N,N-bis(trimethylsilyl)ethanamine.
Molecular Properties
| Compound Name | 2-phenyl-N,N-bis(trimethylsilyl)ethanamine |
| PubChem CID | 599825 |
| Molecular Formula | C14H27NSi2 |
| Molecular Weight | 265.55 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 2-phenyl-N,N-bis(trimethylsilyl)ethanamine |
| SMILES | C[Si](C)(C)N(CCc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C14H27NSi2/c1-16(2,3)15(17(4,5)6)13-12-14-10-8-7-9-11-14/h7-11H,12-13H2,1-6H3 |
| InChIKey | ZMJNXPQHDGIESY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-N,N-bis(trimethylsilyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-N,N-bis(trimethylsilyl)ethanamine?
The IUPAC name of 2-phenyl-N,N-bis(trimethylsilyl)ethanamine (CID 599825) is 2-phenyl-N,N-bis(trimethylsilyl)ethanamine.
What is the SMILES notation for 2-phenyl-N,N-bis(trimethylsilyl)ethanamine?
The canonical SMILES for 2-phenyl-N,N-bis(trimethylsilyl)ethanamine is C[Si](C)(C)N(CCc1ccccc1)[Si](C)(C)C.
What is the InChIKey of 2-phenyl-N,N-bis(trimethylsilyl)ethanamine?
The InChIKey is ZMJNXPQHDGIESY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NSi2/c1-16(2,3)15(17(4,5)6)13-12-14-10-8-7-9-11-14/h7-11H,12-13H2,1-6H3.
What are the key properties of 2-phenyl-N,N-bis(trimethylsilyl)ethanamine?
2-phenyl-N,N-bis(trimethylsilyl)ethanamine has a molecular weight of 265.55 g/mol, XLogP of 4.20, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-N,N-bis(trimethylsilyl)ethanamine is sourced from PubChem (CID 599825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).