C16H22N2Y — CID 59982804
1-methyl-5-[(1E,5E,7E)-7-pyrrolidin-2-ylidenehepta-1,3,5-trienyl]-3,4-dihydro-2H-pyrrol-1-ium;yttrium (PubChem CID 59982804) has the molecular formula C16H22N2Y and a molecular weight of 331.27 g/mol. Its IUPAC name is 1-methyl-5-[(1E,5E,7E)-7-pyrrolidin-2-ylidenehepta-1,3,5-trienyl]-3,4-dihydro-2H-pyrrol-1-ium;yttrium.
| Compound Name | 1-methyl-5-[(1E,5E,7E)-7-pyrrolidin-2-ylidenehepta-1,3,5-trienyl]-3,4-dihydro-2H-pyrrol-1-ium;yttrium |
|---|---|
| PubChem CID | 59982804 |
| Molecular Formula | C16H22N2Y |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 1-methyl-5-[(1E,5E,7E)-7-pyrrolidin-2-ylidenehepta-1,3,5-trienyl]-3,4-dihydro-2H-pyrrol-1-ium;yttrium |
| SMILES | C[N+]1=C(/C=C/C=[C-]/C=C/C=C2\CCCN2)CCC1.[Y] |
| InChI | InChI=1S/C16H21N2.Y/c1-18-14-8-12-16(18)11-6-4-2-3-5-9-15-10-7-13-17-15;/h3-6,9,11H,7-8,10,12-14H2,1H3;/q-1;/p+1 |
| InChIKey | NYJURMLIDAGDPY-UHFFFAOYSA-O |
| XLogP | 2.60 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|