C32H57NO8 — CID 59982893
(3R,5R,6R,7R,9R,11R,12R,13S,14R)-6-[4-(dimethylamino)-3,6-dimethyloxan-2-yl]oxy-14-ethyl-13-hydroxy-7-methoxy-3,5,7,9,11,12,13-heptamethyl-oxacyclotetradecane-2,4,10-trione (PubChem CID 59982893) has the molecular formula C32H57NO8 and a molecular weight of 583.81 g/mol. Its IUPAC name is (3R,5R,6R,7R,9R,11R,12R,13S,14R)-6-[4-(dimethylamino)-3,6-dimethyloxan-2-yl]oxy-14-ethyl-13-hydroxy-7-methoxy-3,5,7,9,11,12,13-heptamethyl-oxacyclotetradecane-2,4,10-trione.
| Compound Name | (3R,5R,6R,7R,9R,11R,12R,13S,14R)-6-[4-(dimethylamino)-3,6-dimethyloxan-2-yl]oxy-14-ethyl-13-hydroxy-7-methoxy-3,5,7,9,11,12,13-heptamethyl-oxacyclotetradecane-2,4,10-trione |
|---|---|
| PubChem CID | 59982893 |
| Molecular Formula | C32H57NO8 |
| Molecular Weight | 583.81 g/mol |
| Exact Mass | 583.41 |
| IUPAC Name | (3R,5R,6R,7R,9R,11R,12R,13S,14R)-6-[4-(dimethylamino)-3,6-dimethyloxan-2-yl]oxy-14-ethyl-13-hydroxy-7-methoxy-3,5,7,9,11,12,13-heptamethyl-oxacyclotetradecane-2,4,10-trione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C(=O)[C@H](C)[C@@H](OC2OC(C)CC(N(C)C)C2C)[C@](C)(OC)C[C@@H](C)C(=O)[C@H](C)[C@@H](C)[C@]1(C)O |
| InChI | InChI=1S/C32H57NO8/c1-14-25-32(10,37)23(8)19(4)26(34)17(2)16-31(9,38-13)28(21(6)27(35)22(7)29(36)40-25)41-30-20(5)24(33(11)12)15-18(3)39-30/h17-25,28,30,37H,14-16H2,1-13H3/t17-,18?,19-,20?,21+,22-,23-,24?,25-,28-,30?,31-,32+/m1/s1 |
| InChIKey | JHOILSXYEAIOSR-RTZNOFQZSA-N |
| XLogP | 4.27 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.81 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|