C29H37N3O3S — CID 59983437
2-methyl-2-[4-[5-methyl-1-pentyl-4-[(2,4,6-trimethylphenyl)carbamoyl]imidazol-2-yl]phenyl]sulfanylpropanoic acid (PubChem CID 59983437) has the molecular formula C29H37N3O3S and a molecular weight of 507.70 g/mol. Its IUPAC name is 2-methyl-2-[4-[5-methyl-1-pentyl-4-[(2,4,6-trimethylphenyl)carbamoyl]imidazol-2-yl]phenyl]sulfanylpropanoic acid.
| Compound Name | 2-methyl-2-[4-[5-methyl-1-pentyl-4-[(2,4,6-trimethylphenyl)carbamoyl]imidazol-2-yl]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 59983437 |
| Molecular Formula | C29H37N3O3S |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 2-methyl-2-[4-[5-methyl-1-pentyl-4-[(2,4,6-trimethylphenyl)carbamoyl]imidazol-2-yl]phenyl]sulfanylpropanoic acid |
| SMILES | CCCCCn1c(-c2ccc(SC(C)(C)C(=O)O)cc2)nc(C(=O)Nc2c(C)cc(C)cc2C)c1C |
| InChI | InChI=1S/C29H37N3O3S/c1-8-9-10-15-32-21(5)25(27(33)31-24-19(3)16-18(2)17-20(24)4)30-26(32)22-11-13-23(14-12-22)36-29(6,7)28(34)35/h11-14,16-17H,8-10,15H2,1-7H3,(H,31,33)(H,34,35) |
| InChIKey | FZNSEKKGKDILPX-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|