About tert-butyl 2-[4-(5-phenyl-1,3-thiazol-2-yl)phenyl]sulfanylpropanoate
tert-butyl 2-[4-(5-phenyl-1,3-thiazol-2-yl)phenyl]sulfanylpropanoate (PubChem CID 59983461) has the molecular formula C22H23NO2S2
and a molecular weight of 397.57 g/mol. Its IUPAC name is tert-butyl 2-[4-(5-phenyl-1,3-thiazol-2-yl)phenyl]sulfanylpropanoate.
Molecular Properties
| Compound Name | tert-butyl 2-[4-(5-phenyl-1,3-thiazol-2-yl)phenyl]sulfanylpropanoate |
| PubChem CID | 59983461 |
| Molecular Formula | C22H23NO2S2 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | tert-butyl 2-[4-(5-phenyl-1,3-thiazol-2-yl)phenyl]sulfanylpropanoate |
| SMILES | CC(Sc1ccc(-c2ncc(-c3ccccc3)s2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H23NO2S2/c1-15(21(24)25-22(2,3)4)26-18-12-10-17(11-13-18)20-23-14-19(27-20)16-8-6-5-7-9-16/h5-15H,1-4H3 |
| InChIKey | GFRLWMLREXCADT-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-[4-(5-phenyl-1,3-thiazol-2-yl)phenyl]sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[4-(5-phenyl-1,3-thiazol-2-yl)phenyl]sulfanylpropanoate?
The IUPAC name of tert-butyl 2-[4-(5-phenyl-1,3-thiazol-2-yl)phenyl]sulfanylpropanoate (CID 59983461) is tert-butyl 2-[4-(5-phenyl-1,3-thiazol-2-yl)phenyl]sulfanylpropanoate.
What is the SMILES notation for tert-butyl 2-[4-(5-phenyl-1,3-thiazol-2-yl)phenyl]sulfanylpropanoate?
The canonical SMILES for tert-butyl 2-[4-(5-phenyl-1,3-thiazol-2-yl)phenyl]sulfanylpropanoate is CC(Sc1ccc(-c2ncc(-c3ccccc3)s2)cc1)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-[4-(5-phenyl-1,3-thiazol-2-yl)phenyl]sulfanylpropanoate?
The InChIKey is GFRLWMLREXCADT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO2S2/c1-15(21(24)25-22(2,3)4)26-18-12-10-17(11-13-18)20-23-14-19(27-20)16-8-6-5-7-9-16/h5-15H,1-4H3.
What are the key properties of tert-butyl 2-[4-(5-phenyl-1,3-thiazol-2-yl)phenyl]sulfanylpropanoate?
tert-butyl 2-[4-(5-phenyl-1,3-thiazol-2-yl)phenyl]sulfanylpropanoate has a molecular weight of 397.57 g/mol, XLogP of 6.30, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[4-(5-phenyl-1,3-thiazol-2-yl)phenyl]sulfanylpropanoate is sourced from PubChem (CID 59983461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).