C27H35N3O4S — CID 59983478
2-[4-[[(Z)-3-amino-1-butoxy-4-(2,4-dimethylanilino)-2-methyl-4-oxobut-2-enylidene]amino]phenyl]sulfanyl-2-methylpropanoic acid (PubChem CID 59983478) has the molecular formula C27H35N3O4S and a molecular weight of 497.66 g/mol. Its IUPAC name is 2-[4-[[(Z)-3-amino-1-butoxy-4-(2,4-dimethylanilino)-2-methyl-4-oxobut-2-enylidene]amino]phenyl]sulfanyl-2-methylpropanoic acid.
| Compound Name | 2-[4-[[(Z)-3-amino-1-butoxy-4-(2,4-dimethylanilino)-2-methyl-4-oxobut-2-enylidene]amino]phenyl]sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 59983478 |
| Molecular Formula | C27H35N3O4S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 2-[4-[[(Z)-3-amino-1-butoxy-4-(2,4-dimethylanilino)-2-methyl-4-oxobut-2-enylidene]amino]phenyl]sulfanyl-2-methylpropanoic acid |
| SMILES | CCCCOC(=N\c1ccc(SC(C)(C)C(=O)O)cc1)/C(C)=C(\N)C(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C27H35N3O4S/c1-7-8-15-34-25(29-20-10-12-21(13-11-20)35-27(5,6)26(32)33)19(4)23(28)24(31)30-22-14-9-17(2)16-18(22)3/h9-14,16H,7-8,15,28H2,1-6H3,(H,30,31)(H,32,33)/b23-19-,29-25- |
| InChIKey | IWOHOZHSDVMAKM-IKLXCSCISA-N |
| XLogP | 5.98 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|