C17H35NOSi3 — CID 599838
N,N-bis(trimethylsilyl)-2-(4-trimethylsilyloxyphenyl)ethanamine (PubChem CID 599838) has the molecular formula C17H35NOSi3 and a molecular weight of 353.73 g/mol. Its IUPAC name is N,N-bis(trimethylsilyl)-2-(4-trimethylsilyloxyphenyl)ethanamine.
| Compound Name | N,N-bis(trimethylsilyl)-2-(4-trimethylsilyloxyphenyl)ethanamine |
|---|---|
| PubChem CID | 599838 |
| Molecular Formula | C17H35NOSi3 |
| Molecular Weight | 353.73 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | N,N-bis(trimethylsilyl)-2-(4-trimethylsilyloxyphenyl)ethanamine |
| SMILES | C[Si](C)(C)Oc1ccc(CCN([Si](C)(C)C)[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C17H35NOSi3/c1-20(2,3)18(21(4,5)6)15-14-16-10-12-17(13-11-16)19-22(7,8)9/h10-13H,14-15H2,1-9H3 |
| InChIKey | WDQQWJKBIMOZAK-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.73 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|