C20H38O4S — CID 59984690
8-(7-carboxy-5,5-dimethylheptyl)sulfanyl-4,4-dimethyloctanoic acid (PubChem CID 59984690) has the molecular formula C20H38O4S and a molecular weight of 374.59 g/mol. Its IUPAC name is 8-(7-carboxy-5,5-dimethylheptyl)sulfanyl-4,4-dimethyloctanoic acid.
| Compound Name | 8-(7-carboxy-5,5-dimethylheptyl)sulfanyl-4,4-dimethyloctanoic acid |
|---|---|
| PubChem CID | 59984690 |
| Molecular Formula | C20H38O4S |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 8-(7-carboxy-5,5-dimethylheptyl)sulfanyl-4,4-dimethyloctanoic acid |
| SMILES | CC(C)(CCCCSCCCCC(C)(C)CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C20H38O4S/c1-19(2,13-9-17(21)22)11-5-7-15-25-16-8-6-12-20(3,4)14-10-18(23)24/h5-16H2,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | ZKHLKXOTOLUHQC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|