C23F9N5O2 — CID 59984779
4-[4-(3-cyano-2,6-difluoro-4,5-diisocyanophenoxy)-2,3,5,6-tetrafluorophenoxy]-3,5,6-trifluorobenzene-1,2-dicarbonitrile (PubChem CID 59984779) has the molecular formula C23F9N5O2 and a molecular weight of 549.27 g/mol. Its IUPAC name is 4-[4-(3-cyano-2,6-difluoro-4,5-diisocyanophenoxy)-2,3,5,6-tetrafluorophenoxy]-3,5,6-trifluorobenzene-1,2-dicarbonitrile.
| Compound Name | 4-[4-(3-cyano-2,6-difluoro-4,5-diisocyanophenoxy)-2,3,5,6-tetrafluorophenoxy]-3,5,6-trifluorobenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 59984779 |
| Molecular Formula | C23F9N5O2 |
| Molecular Weight | 549.27 g/mol |
| Exact Mass | 548.99 |
| IUPAC Name | 4-[4-(3-cyano-2,6-difluoro-4,5-diisocyanophenoxy)-2,3,5,6-tetrafluorophenoxy]-3,5,6-trifluorobenzene-1,2-dicarbonitrile |
| SMILES | [C-]#[N+]c1c(F)c(Oc2c(F)c(F)c(Oc3c(F)c(F)c(C#N)c(C#N)c3F)c(F)c2F)c(F)c(C#N)c1[N+]#[C-] |
| InChI | InChI=1S/C23F9N5O2/c1-36-18-8(5-35)11(26)21(17(32)19(18)37-2)39-23-15(30)13(28)22(14(29)16(23)31)38-20-10(25)7(4-34)6(3-33)9(24)12(20)27 |
| InChIKey | XNFCFWFPOFJUKM-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 98.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.27 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|