C22H28N4O2 — CID 59984896
(11S,16R)-N-(2-propoxy-3-pyridinyl)-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-trien-3-amine (PubChem CID 59984896) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is (11S,16R)-N-(2-propoxy-3-pyridinyl)-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-trien-3-amine.
| Compound Name | (11S,16R)-N-(2-propoxy-3-pyridinyl)-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-trien-3-amine |
|---|---|
| PubChem CID | 59984896 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (11S,16R)-N-(2-propoxy-3-pyridinyl)-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-trien-3-amine |
| SMILES | CCCOc1ncccc1Nc1cc2c3c(c1)[C@@H]1CNCC[C@@H]1N3CCOC2 |
| InChI | InChI=1S/C22H28N4O2/c1-2-9-28-22-19(4-3-6-24-22)25-16-11-15-14-27-10-8-26-20-5-7-23-13-18(20)17(12-16)21(15)26/h3-4,6,11-12,18,20,23,25H,2,5,7-10,13-14H2,1H3/t18-,20-/m0/s1 |
| InChIKey | SKLQHDNIXLSPFQ-ICSRJNTNSA-N |
| XLogP | 3.41 |
| TPSA | 58.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |