C21H26N4OS — CID 59984905
(11S,16R)-N-(2-ethoxy-3-pyridinyl)-7-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-trien-3-amine (PubChem CID 59984905) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is (11S,16R)-N-(2-ethoxy-3-pyridinyl)-7-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-trien-3-amine.
| Compound Name | (11S,16R)-N-(2-ethoxy-3-pyridinyl)-7-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-trien-3-amine |
|---|---|
| PubChem CID | 59984905 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (11S,16R)-N-(2-ethoxy-3-pyridinyl)-7-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-trien-3-amine |
| SMILES | CCOc1ncccc1Nc1cc2c3c(c1)[C@@H]1CNCC[C@@H]1N3CCSC2 |
| InChI | InChI=1S/C21H26N4OS/c1-2-26-21-18(4-3-6-23-21)24-15-10-14-13-27-9-8-25-19-5-7-22-12-17(19)16(11-15)20(14)25/h3-4,6,10-11,17,19,22,24H,2,5,7-9,12-13H2,1H3/t17-,19-/m0/s1 |
| InChIKey | JWKOXOMHTWINGJ-HKUYNNGSSA-N |
| XLogP | 3.74 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |