C8H14N2OY-2 — CID 59984983
N-methylpropanamide;2,3,4,5-tetrahydropyrrol-5-ide;yttrium (PubChem CID 59984983) has the molecular formula C8H14N2OY-2 and a molecular weight of 243.12 g/mol. Its IUPAC name is N-methylpropanamide;2,3,4,5-tetrahydropyrrol-5-ide;yttrium.
| Compound Name | N-methylpropanamide;2,3,4,5-tetrahydropyrrol-5-ide;yttrium |
|---|---|
| PubChem CID | 59984983 |
| Molecular Formula | C8H14N2OY-2 |
| Molecular Weight | 243.12 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | N-methylpropanamide;2,3,4,5-tetrahydropyrrol-5-ide;yttrium |
| SMILES | [C-]1=NCCC1.[CH2-]CC(=O)NC.[Y] |
| InChI | InChI=1S/C4H8NO.C4H6N.Y/c1-3-4(6)5-2;1-2-4-5-3-1;/h1,3H2,2H3,(H,5,6);1-3H2;/q2*-1; |
| InChIKey | QWJHAKQQOGEOIS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.12 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|