C34H48N4O5S — CID 59985258
(2S)-2-[[4-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]phenyl]methyl-pentanoylamino]-N-hexyl-3-methylbutanamide (PubChem CID 59985258) has the molecular formula C34H48N4O5S and a molecular weight of 624.85 g/mol. Its IUPAC name is (2S)-2-[[4-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]phenyl]methyl-pentanoylamino]-N-hexyl-3-methylbutanamide.
| Compound Name | (2S)-2-[[4-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]phenyl]methyl-pentanoylamino]-N-hexyl-3-methylbutanamide |
|---|---|
| PubChem CID | 59985258 |
| Molecular Formula | C34H48N4O5S |
| Molecular Weight | 624.85 g/mol |
| Exact Mass | 624.33 |
| IUPAC Name | (2S)-2-[[4-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]phenyl]methyl-pentanoylamino]-N-hexyl-3-methylbutanamide |
| SMILES | CCCCCCNC(=O)[C@H](C(C)C)N(Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1)C(=O)CCCC |
| InChI | InChI=1S/C34H48N4O5S/c1-7-9-11-14-22-35-33(40)32(24(3)4)38(31(39)17-10-8-2)23-27-18-20-28(21-19-27)29-15-12-13-16-30(29)44(41,42)37-34-25(5)26(6)36-43-34/h12-13,15-16,18-21,24,32,37H,7-11,14,17,22-23H2,1-6H3,(H,35,40)/t32-/m0/s1 |
| InChIKey | TZYAEIDBFBKSIP-YTTGMZPUSA-N |
| XLogP | 7.00 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.85 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|