C30H46N2O7 — CID 59985421
[(4E,6Z,8S,9S,10E,12R,13S,14S,16S,17R)-20,22-dihydroxy-8,17-dimethoxy-4,10,12,13,14,16-hexamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate (PubChem CID 59985421) has the molecular formula C30H46N2O7 and a molecular weight of 546.71 g/mol. Its IUPAC name is [(4E,6Z,8S,9S,10E,12R,13S,14S,16S,17R)-20,22-dihydroxy-8,17-dimethoxy-4,10,12,13,14,16-hexamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate.
| Compound Name | [(4E,6Z,8S,9S,10E,12R,13S,14S,16S,17R)-20,22-dihydroxy-8,17-dimethoxy-4,10,12,13,14,16-hexamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
|---|---|
| PubChem CID | 59985421 |
| Molecular Formula | C30H46N2O7 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | [(4E,6Z,8S,9S,10E,12R,13S,14S,16S,17R)-20,22-dihydroxy-8,17-dimethoxy-4,10,12,13,14,16-hexamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
| SMILES | CO[C@H]1/C=C\C=C(/C)C(=O)NC2=CC(O)C=C(C2O)[C@H](OC)[C@@H](C)C[C@H](C)[C@H](C)[C@@H](C)/C=C(\C)[C@@H]1OC(N)=O |
| InChI | InChI=1S/C30H46N2O7/c1-16-10-9-11-25(37-7)28(39-30(31)36)20(5)13-18(3)21(6)17(2)12-19(4)27(38-8)23-14-22(33)15-24(26(23)34)32-29(16)35/h9-11,13-15,17-19,21-22,25-28,33-34H,12H2,1-8H3,(H2,31,36)(H,32,35)/b11-9-,16-10+,20-13+/t17-,18-,19-,21-,22?,25-,26?,27+,28-/m0/s1 |
| InChIKey | XTIVEFUTYSLLBO-OXMPRBLFSA-N |
| XLogP | 3.54 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|