About 2-tert-butyl-1,4-dihydroimidazol-4-ide;rubidium(1+)
2-tert-butyl-1,4-dihydroimidazol-4-ide;rubidium(1+) (PubChem CID 59985764) has the molecular formula C7H11N2Rb
and a molecular weight of 208.65 g/mol. Its IUPAC name is 2-tert-butyl-1,4-dihydroimidazol-4-ide;rubidium(1+).
Molecular Properties
| Compound Name | 2-tert-butyl-1,4-dihydroimidazol-4-ide;rubidium(1+) |
| PubChem CID | 59985764 |
| Molecular Formula | C7H11N2Rb |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.00 |
| IUPAC Name | 2-tert-butyl-1,4-dihydroimidazol-4-ide;rubidium(1+) |
| SMILES | CC(C)(C)c1n[c-]c[nH]1.[Rb+] |
| InChI | InChI=1S/C7H11N2.Rb/c1-7(2,3)6-8-4-5-9-6;/h4H,1-3H3,(H,8,9);/q-1;+1 |
| InChIKey | FKNCNAPXEYNWJE-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-1,4-dihydroimidazol-4-ide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1,4-dihydroimidazol-4-ide;rubidium(1+)?
The IUPAC name of 2-tert-butyl-1,4-dihydroimidazol-4-ide;rubidium(1+) (CID 59985764) is 2-tert-butyl-1,4-dihydroimidazol-4-ide;rubidium(1+).
What is the SMILES notation for 2-tert-butyl-1,4-dihydroimidazol-4-ide;rubidium(1+)?
The canonical SMILES for 2-tert-butyl-1,4-dihydroimidazol-4-ide;rubidium(1+) is CC(C)(C)c1n[c-]c[nH]1.[Rb+].
What is the InChIKey of 2-tert-butyl-1,4-dihydroimidazol-4-ide;rubidium(1+)?
The InChIKey is FKNCNAPXEYNWJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N2.Rb/c1-7(2,3)6-8-4-5-9-6;/h4H,1-3H3,(H,8,9);/q-1;+1.
What are the key properties of 2-tert-butyl-1,4-dihydroimidazol-4-ide;rubidium(1+)?
2-tert-butyl-1,4-dihydroimidazol-4-ide;rubidium(1+) has a molecular weight of 208.65 g/mol, XLogP of -1.49, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1,4-dihydroimidazol-4-ide;rubidium(1+) is sourced from PubChem (CID 59985764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).