About 4-(bromomethyl)-2,2-dimethyl-1,6-dihydroquinolin-6-ide;yttrium
4-(bromomethyl)-2,2-dimethyl-1,6-dihydroquinolin-6-ide;yttrium (PubChem CID 59985843) has the molecular formula C12H13BrNY-
and a molecular weight of 340.05 g/mol. Its IUPAC name is 4-(bromomethyl)-2,2-dimethyl-1,6-dihydroquinolin-6-ide;yttrium.
Molecular Properties
| Compound Name | 4-(bromomethyl)-2,2-dimethyl-1,6-dihydroquinolin-6-ide;yttrium |
| PubChem CID | 59985843 |
| Molecular Formula | C12H13BrNY- |
| Molecular Weight | 340.05 g/mol |
| Exact Mass | 338.93 |
| IUPAC Name | 4-(bromomethyl)-2,2-dimethyl-1,6-dihydroquinolin-6-ide;yttrium |
| SMILES | CC1(C)C=C(CBr)c2c[c-]ccc2N1.[Y] |
| InChI | InChI=1S/C12H13BrN.Y/c1-12(2)7-9(8-13)10-5-3-4-6-11(10)14-12;/h4-7,14H,8H2,1-2H3;/q-1; |
| InChIKey | GQIDABWHNYIVHJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.05 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)-2,2-dimethyl-1,6-dihydroquinolin-6-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)-2,2-dimethyl-1,6-dihydroquinolin-6-ide;yttrium?
The IUPAC name of 4-(bromomethyl)-2,2-dimethyl-1,6-dihydroquinolin-6-ide;yttrium (CID 59985843) is 4-(bromomethyl)-2,2-dimethyl-1,6-dihydroquinolin-6-ide;yttrium.
What is the SMILES notation for 4-(bromomethyl)-2,2-dimethyl-1,6-dihydroquinolin-6-ide;yttrium?
The canonical SMILES for 4-(bromomethyl)-2,2-dimethyl-1,6-dihydroquinolin-6-ide;yttrium is CC1(C)C=C(CBr)c2c[c-]ccc2N1.[Y].
What is the InChIKey of 4-(bromomethyl)-2,2-dimethyl-1,6-dihydroquinolin-6-ide;yttrium?
The InChIKey is GQIDABWHNYIVHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrN.Y/c1-12(2)7-9(8-13)10-5-3-4-6-11(10)14-12;/h4-7,14H,8H2,1-2H3;/q-1;.
What are the key properties of 4-(bromomethyl)-2,2-dimethyl-1,6-dihydroquinolin-6-ide;yttrium?
4-(bromomethyl)-2,2-dimethyl-1,6-dihydroquinolin-6-ide;yttrium has a molecular weight of 340.05 g/mol, XLogP of 3.47, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)-2,2-dimethyl-1,6-dihydroquinolin-6-ide;yttrium is sourced from PubChem (CID 59985843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).