C24H34N2O8 — CID 59985916
[(2R,3R,5S,6R)-5-[acetyl(benzyl)amino]-3,4-diacetyloxy-6-(ethylaminomethyl)oxan-2-yl]methyl acetate (PubChem CID 59985916) has the molecular formula C24H34N2O8 and a molecular weight of 478.54 g/mol. Its IUPAC name is [(2R,3R,5S,6R)-5-[acetyl(benzyl)amino]-3,4-diacetyloxy-6-(ethylaminomethyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,5S,6R)-5-[acetyl(benzyl)amino]-3,4-diacetyloxy-6-(ethylaminomethyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 59985916 |
| Molecular Formula | C24H34N2O8 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | [(2R,3R,5S,6R)-5-[acetyl(benzyl)amino]-3,4-diacetyloxy-6-(ethylaminomethyl)oxan-2-yl]methyl acetate |
| SMILES | CCNC[C@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)C(OC(C)=O)[C@H]1N(Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C24H34N2O8/c1-6-25-12-20-22(26(15(2)27)13-19-10-8-7-9-11-19)24(33-18(5)30)23(32-17(4)29)21(34-20)14-31-16(3)28/h7-11,20-25H,6,12-14H2,1-5H3/t20-,21-,22+,23+,24?/m1/s1 |
| InChIKey | GAGPWNOUJABNPG-SFGZKKEESA-N |
| XLogP | 1.21 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|