C8H14BNO5 — CID 59985924
CID 59985924 (PubChem CID 59985924) has the molecular formula C8H14BNO5 and a molecular weight of 215.01 g/mol.
| Compound Name | CID 59985924 |
|---|---|
| PubChem CID | 59985924 |
| Molecular Formula | C8H14BNO5 |
| Molecular Weight | 215.01 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | — |
| SMILES | [B]O[C@H]1[C@@H](O)[C@@H](C)O[C@H](O)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C8H14BNO5/c1-3-6(12)7(15-9)5(8(13)14-3)10-4(2)11/h3,5-8,12-13H,1-2H3,(H,10,11)/t3-,5-,6+,7-,8+/m1/s1 |
| InChIKey | VVDWWAHEJZDPRR-VDUCJHRSSA-N |
| XLogP | -1.94 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.01 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|