About 3-amino-4-methylhexane-2,5-dione
3-amino-4-methylhexane-2,5-dione (PubChem CID 59986048) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 3-amino-4-methylhexane-2,5-dione.
Molecular Properties
| Compound Name | 3-amino-4-methylhexane-2,5-dione |
| PubChem CID | 59986048 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 3-amino-4-methylhexane-2,5-dione |
| SMILES | CC(=O)C(C)C(N)C(C)=O |
| InChI | InChI=1S/C7H13NO2/c1-4(5(2)9)7(8)6(3)10/h4,7H,8H2,1-3H3 |
| InChIKey | UMXTWRUIXRSWJX-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-4-methylhexane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-methylhexane-2,5-dione?
The IUPAC name of 3-amino-4-methylhexane-2,5-dione (CID 59986048) is 3-amino-4-methylhexane-2,5-dione.
What is the SMILES notation for 3-amino-4-methylhexane-2,5-dione?
The canonical SMILES for 3-amino-4-methylhexane-2,5-dione is CC(=O)C(C)C(N)C(C)=O.
What is the InChIKey of 3-amino-4-methylhexane-2,5-dione?
The InChIKey is UMXTWRUIXRSWJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-4(5(2)9)7(8)6(3)10/h4,7H,8H2,1-3H3.
What are the key properties of 3-amino-4-methylhexane-2,5-dione?
3-amino-4-methylhexane-2,5-dione has a molecular weight of 143.19 g/mol, XLogP of 0.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-methylhexane-2,5-dione is sourced from PubChem (CID 59986048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).