C10H16O2 — CID 59986087
(3-methyl-2,3,3a,4,5,7a-hexahydro-1-benzofuran-6-yl)methanol (PubChem CID 59986087) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (3-methyl-2,3,3a,4,5,7a-hexahydro-1-benzofuran-6-yl)methanol.
| Compound Name | (3-methyl-2,3,3a,4,5,7a-hexahydro-1-benzofuran-6-yl)methanol |
|---|---|
| PubChem CID | 59986087 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (3-methyl-2,3,3a,4,5,7a-hexahydro-1-benzofuran-6-yl)methanol |
| SMILES | CC1COC2C=C(CO)CCC12 |
| InChI | InChI=1S/C10H16O2/c1-7-6-12-10-4-8(5-11)2-3-9(7)10/h4,7,9-11H,2-3,5-6H2,1H3 |
| InChIKey | FLERBNPBXKJHBN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|