C10H14O — CID 59986092
3,6-dimethyl-2,3,4,7-tetrahydro-1-benzofuran (PubChem CID 59986092) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 3,6-dimethyl-2,3,4,7-tetrahydro-1-benzofuran.
| Compound Name | 3,6-dimethyl-2,3,4,7-tetrahydro-1-benzofuran |
|---|---|
| PubChem CID | 59986092 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 3,6-dimethyl-2,3,4,7-tetrahydro-1-benzofuran |
| SMILES | CC1=CCC2=C(C1)OCC2C |
| InChI | InChI=1S/C10H14O/c1-7-3-4-9-8(2)6-11-10(9)5-7/h3,8H,4-6H2,1-2H3 |
| InChIKey | RQWBOKQXDMZWFS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|