C41H52BN6O3 — CID 59986384
CID 59986384 (PubChem CID 59986384) has the molecular formula C41H52BN6O3 and a molecular weight of 687.72 g/mol.
| Compound Name | CID 59986384 |
|---|---|
| PubChem CID | 59986384 |
| Molecular Formula | C41H52BN6O3 |
| Molecular Weight | 687.72 g/mol |
| Exact Mass | 687.42 |
| IUPAC Name | — |
| SMILES | CC(C)[C@H](NC(=O)c1ccc2ccccc2n1)C(=O)N[C@H](CCN1CC[C@@H]([B]Cc2cccnc2)C[C@H]1C(=O)NC(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C41H52BN6O3/c1-28(2)37(46-38(49)35-18-17-31-15-9-10-16-34(31)45-35)40(51)44-33(24-29-12-7-6-8-13-29)20-23-48-22-19-32(42-26-30-14-11-21-43-27-30)25-36(48)39(50)47-41(3,4)5/h6-18,21,27-28,32-33,36-37H,19-20,22-26H2,1-5H3,(H,44,51)(H,46,49)(H,47,50)/t32-,33-,36+,37+/m1/s1 |
| InChIKey | UFPXQFSXZBBJQR-OMNWBGIJSA-N |
| XLogP | 5.57 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.72 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|