About (2S)-N-(2,3-dihydroxypropyl)-3-methyl-2-(methylamino)butanamide
(2S)-N-(2,3-dihydroxypropyl)-3-methyl-2-(methylamino)butanamide (PubChem CID 59986552) has the molecular formula C9H20N2O3
and a molecular weight of 204.27 g/mol. Its IUPAC name is (2S)-N-(2,3-dihydroxypropyl)-3-methyl-2-(methylamino)butanamide.
Molecular Properties
| Compound Name | (2S)-N-(2,3-dihydroxypropyl)-3-methyl-2-(methylamino)butanamide |
| PubChem CID | 59986552 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (2S)-N-(2,3-dihydroxypropyl)-3-methyl-2-(methylamino)butanamide |
| SMILES | CN[C@H](C(=O)NCC(O)CO)C(C)C |
| InChI | InChI=1S/C9H20N2O3/c1-6(2)8(10-3)9(14)11-4-7(13)5-12/h6-8,10,12-13H,4-5H2,1-3H3,(H,11,14)/t7?,8-/m0/s1 |
| InChIKey | AHTQSABDXVNHQS-MQWKRIRWSA-N |
| XLogP | -1.30 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-N-(2,3-dihydroxypropyl)-3-methyl-2-(methylamino)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-(2,3-dihydroxypropyl)-3-methyl-2-(methylamino)butanamide?
The IUPAC name of (2S)-N-(2,3-dihydroxypropyl)-3-methyl-2-(methylamino)butanamide (CID 59986552) is (2S)-N-(2,3-dihydroxypropyl)-3-methyl-2-(methylamino)butanamide.
What is the SMILES notation for (2S)-N-(2,3-dihydroxypropyl)-3-methyl-2-(methylamino)butanamide?
The canonical SMILES for (2S)-N-(2,3-dihydroxypropyl)-3-methyl-2-(methylamino)butanamide is CN[C@H](C(=O)NCC(O)CO)C(C)C.
What is the InChIKey of (2S)-N-(2,3-dihydroxypropyl)-3-methyl-2-(methylamino)butanamide?
The InChIKey is AHTQSABDXVNHQS-MQWKRIRWSA-N. The full InChI is InChI=1S/C9H20N2O3/c1-6(2)8(10-3)9(14)11-4-7(13)5-12/h6-8,10,12-13H,4-5H2,1-3H3,(H,11,14)/t7?,8-/m0/s1.
What are the key properties of (2S)-N-(2,3-dihydroxypropyl)-3-methyl-2-(methylamino)butanamide?
(2S)-N-(2,3-dihydroxypropyl)-3-methyl-2-(methylamino)butanamide has a molecular weight of 204.27 g/mol, XLogP of -1.30, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-(2,3-dihydroxypropyl)-3-methyl-2-(methylamino)butanamide is sourced from PubChem (CID 59986552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).