C24H27N3O3 — CID 59986830
1,5-diacetyl-3,7-dimethyl-2,4-dipyridin-2-yl-3-azabicyclo[3.3.1]nonan-9-one (PubChem CID 59986830) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 1,5-diacetyl-3,7-dimethyl-2,4-dipyridin-2-yl-3-azabicyclo[3.3.1]nonan-9-one.
| Compound Name | 1,5-diacetyl-3,7-dimethyl-2,4-dipyridin-2-yl-3-azabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 59986830 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 1,5-diacetyl-3,7-dimethyl-2,4-dipyridin-2-yl-3-azabicyclo[3.3.1]nonan-9-one |
| SMILES | CC(=O)C12CC(C)CC(C(C)=O)(C1=O)C(c1ccccn1)N(C)C2c1ccccn1 |
| InChI | InChI=1S/C24H27N3O3/c1-15-13-23(16(2)28)20(18-9-5-7-11-25-18)27(4)21(19-10-6-8-12-26-19)24(14-15,17(3)29)22(23)30/h5-12,15,20-21H,13-14H2,1-4H3 |
| InChIKey | QMPCGHGKDFDEON-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|