C16H40O9Si5 — CID 59987090
3-[6-(1,4-dioxocan-2-yl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl-trimethoxysilane (PubChem CID 59987090) has the molecular formula C16H40O9Si5 and a molecular weight of 516.92 g/mol. Its IUPAC name is 3-[6-(1,4-dioxocan-2-yl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl-trimethoxysilane.
| Compound Name | 3-[6-(1,4-dioxocan-2-yl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl-trimethoxysilane |
|---|---|
| PubChem CID | 59987090 |
| Molecular Formula | C16H40O9Si5 |
| Molecular Weight | 516.92 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 3-[6-(1,4-dioxocan-2-yl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl-trimethoxysilane |
| SMILES | CO[Si](CCC[Si]1(C)O[SiH](C)O[Si](C)(C2COCCCCO2)O[SiH](C)O1)(OC)OC |
| InChI | InChI=1S/C16H40O9Si5/c1-17-30(18-2,19-3)14-10-13-28(6)22-26(4)24-29(7,25-27(5)23-28)16-15-20-11-8-9-12-21-16/h16,26-27H,8-15H2,1-7H3 |
| InChIKey | INNGWTZJPSRTDB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.92 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|