C15H24N2O5 — CID 59987295
4-(2,5-dioxopyrrol-1-yl)-N-[3-(2-ethoxyethoxy)(1,2,3-13C3)propyl]butanamide (PubChem CID 59987295) has the molecular formula C15H24N2O5 and a molecular weight of 315.34 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)-N-[3-(2-ethoxyethoxy)(1,2,3-13C3)propyl]butanamide.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)-N-[3-(2-ethoxyethoxy)(1,2,3-13C3)propyl]butanamide |
|---|---|
| PubChem CID | 59987295 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)-N-[3-(2-ethoxyethoxy)(1,2,3-13C3)propyl]butanamide |
| SMILES | CCOCCO[13CH2][13CH2][13CH2]NC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H24N2O5/c1-2-21-11-12-22-10-4-8-16-13(18)5-3-9-17-14(19)6-7-15(17)20/h6-7H,2-5,8-12H2,1H3,(H,16,18)/i4+1,8+1,10+1 |
| InChIKey | WQZSTEDJNNOZRY-PTCNTQLJSA-N |
| XLogP | 0.25 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|