C27H38N2O5 — CID 59987653
[(1R,4aR,6S,7R,8Z,11R,12aR)-11-acetyloxy-7-hydroxy-4-methyl-1-propan-2-yl-1,2,4a,5,6,7,10,11,12,12a-decahydrobenzo[10]annulen-6-yl] (E)-3-(1-methylimidazol-4-yl)prop-2-enoate (PubChem CID 59987653) has the molecular formula C27H38N2O5 and a molecular weight of 470.61 g/mol. Its IUPAC name is [(1R,4aR,6S,7R,8Z,11R,12aR)-11-acetyloxy-7-hydroxy-4-methyl-1-propan-2-yl-1,2,4a,5,6,7,10,11,12,12a-decahydrobenzo[10]annulen-6-yl] (E)-3-(1-methylimidazol-4-yl)prop-2-enoate.
| Compound Name | [(1R,4aR,6S,7R,8Z,11R,12aR)-11-acetyloxy-7-hydroxy-4-methyl-1-propan-2-yl-1,2,4a,5,6,7,10,11,12,12a-decahydrobenzo[10]annulen-6-yl] (E)-3-(1-methylimidazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 59987653 |
| Molecular Formula | C27H38N2O5 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | [(1R,4aR,6S,7R,8Z,11R,12aR)-11-acetyloxy-7-hydroxy-4-methyl-1-propan-2-yl-1,2,4a,5,6,7,10,11,12,12a-decahydrobenzo[10]annulen-6-yl] (E)-3-(1-methylimidazol-4-yl)prop-2-enoate |
| SMILES | CC(=O)O[C@@H]1C/C=C\[C@@H](O)[C@@H](OC(=O)/C=C/c2cn(C)cn2)C[C@H]2C(C)=CC[C@H](C(C)C)[C@H]2C1 |
| InChI | InChI=1S/C27H38N2O5/c1-17(2)22-11-9-18(3)23-14-26(34-27(32)12-10-20-15-29(5)16-28-20)25(31)8-6-7-21(13-24(22)23)33-19(4)30/h6,8-10,12,15-17,21-26,31H,7,11,13-14H2,1-5H3/b8-6-,12-10+/t21-,22-,23+,24-,25-,26+/m1/s1 |
| InChIKey | OZLBUZDBFMJWRL-YTKINFJXSA-N |
| XLogP | 4.23 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|