C17H28O — CID 59987661
(1R,2R,6R)-3-methyl-2-(2-methylpent-4-enyl)-6-propan-2-ylcyclohex-3-ene-1-carbaldehyde (PubChem CID 59987661) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is (1R,2R,6R)-3-methyl-2-(2-methylpent-4-enyl)-6-propan-2-ylcyclohex-3-ene-1-carbaldehyde.
| Compound Name | (1R,2R,6R)-3-methyl-2-(2-methylpent-4-enyl)-6-propan-2-ylcyclohex-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 59987661 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (1R,2R,6R)-3-methyl-2-(2-methylpent-4-enyl)-6-propan-2-ylcyclohex-3-ene-1-carbaldehyde |
| SMILES | C=CCC(C)C[C@H]1C(C)=CC[C@H](C(C)C)[C@H]1C=O |
| InChI | InChI=1S/C17H28O/c1-6-7-13(4)10-16-14(5)8-9-15(12(2)3)17(16)11-18/h6,8,11-13,15-17H,1,7,9-10H2,2-5H3/t13?,15-,16+,17-/m1/s1 |
| InChIKey | QAPINXSLHRDQKK-CVGRLMLNSA-N |
| XLogP | 4.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|