C20H36O5S — CID 59987675
[(1R,2R,6R)-2-[(2S,3S)-3-(methoxymethoxy)-2-methylpent-4-enyl]-3-methyl-6-propan-2-ylcyclohex-3-en-1-yl]methyl methanesulfonate (PubChem CID 59987675) has the molecular formula C20H36O5S and a molecular weight of 388.57 g/mol. Its IUPAC name is [(1R,2R,6R)-2-[(2S,3S)-3-(methoxymethoxy)-2-methylpent-4-enyl]-3-methyl-6-propan-2-ylcyclohex-3-en-1-yl]methyl methanesulfonate.
| Compound Name | [(1R,2R,6R)-2-[(2S,3S)-3-(methoxymethoxy)-2-methylpent-4-enyl]-3-methyl-6-propan-2-ylcyclohex-3-en-1-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 59987675 |
| Molecular Formula | C20H36O5S |
| Molecular Weight | 388.57 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | [(1R,2R,6R)-2-[(2S,3S)-3-(methoxymethoxy)-2-methylpent-4-enyl]-3-methyl-6-propan-2-ylcyclohex-3-en-1-yl]methyl methanesulfonate |
| SMILES | C=C[C@H](OCOC)[C@@H](C)C[C@H]1C(C)=CC[C@H](C(C)C)[C@H]1COS(C)(=O)=O |
| InChI | InChI=1S/C20H36O5S/c1-8-20(24-13-23-6)16(5)11-18-15(4)9-10-17(14(2)3)19(18)12-25-26(7,21)22/h8-9,14,16-20H,1,10-13H2,2-7H3/t16-,17+,18-,19+,20-/m0/s1 |
| InChIKey | GWHYVOLVODTPRO-YHDCXSKOSA-N |
| XLogP | 4.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|