C19H34O2 — CID 59987682
(4R,5R,6R)-5-(dimethoxymethyl)-1-methyl-6-(2-methylpent-4-enyl)-4-propan-2-ylcyclohexene (PubChem CID 59987682) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is (4R,5R,6R)-5-(dimethoxymethyl)-1-methyl-6-(2-methylpent-4-enyl)-4-propan-2-ylcyclohexene.
| Compound Name | (4R,5R,6R)-5-(dimethoxymethyl)-1-methyl-6-(2-methylpent-4-enyl)-4-propan-2-ylcyclohexene |
|---|---|
| PubChem CID | 59987682 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | (4R,5R,6R)-5-(dimethoxymethyl)-1-methyl-6-(2-methylpent-4-enyl)-4-propan-2-ylcyclohexene |
| SMILES | C=CCC(C)C[C@H]1C(C)=CC[C@H](C(C)C)[C@H]1C(OC)OC |
| InChI | InChI=1S/C19H34O2/c1-8-9-14(4)12-17-15(5)10-11-16(13(2)3)18(17)19(20-6)21-7/h8,10,13-14,16-19H,1,9,11-12H2,2-7H3/t14?,16-,17+,18-/m1/s1 |
| InChIKey | VMISIMDIOQCXOI-NXCDMZCRSA-N |
| XLogP | 5.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|